
Nutzen Sie die Schnellsuche, um nach den aktuellsten Gesetzen in unserer Datenbank zu suchen!

Anlage 1 KrWaffG
Ausführungsgesetz zu Artikel 26 Abs. 2 des Grundgesetzes (Gesetz über die Kontrolle von Kriegswaffen)


Titel: Ausführungsgesetz zu Artikel 26 Abs. 2 des Grundgesetzes (Gesetz über die Kontrolle von Kriegswaffen)
Normgeber: Bund
Redaktionelle Abkürzung: KrWaffG
Gliederungs-Nr.: 190-1
Normtyp: Gesetz

Anlage 1 KrWaffG – Kriegswaffenliste

(zu § 1 Abs. 1)


Teil A

Kriegswaffen, auf deren Herstellung die Bundesrepublik Deutschland verzichtet hat (Atomwaffen, biologische und chemische Waffen)

Von der Begriffsbestimmung der Waffen ausgenommen sind alle Vorrichtungen, Teile, Geräte, Einrichtungen, Substanzen und Organismen, die zivilen Zwecken oder der wissenschaftlichen, medizinischen oder industriellen Forschung auf den Gebieten der reinen und angewandten Wissenschaft dienen. Ausgenommen sind auch die Substanzen und Organismen der Nummern 3 und 5, soweit sie zu Vorbeugungs-, Schutz- oder Nachweiszwecken dienen.

  1. I.


    1. 1.

      Waffen aller Art, die Kernbrennstoffe oder radioaktive Isotope enthalten oder eigens dazu bestimmt sind, solche aufzunehmen oder zu verwenden, und Massenzerstörungen, Massenschäden oder Massenvergiftungen hervorrufen können

    2. 2.

      Teile, Vorrichtungen, Baugruppen oder Substanzen, die eigens für eine in Nummer 1 genannte Waffe bestimmt sind oder die für sie wesentlich sind, soweit keine atomrechtlichen Genehmigungen erteilt sind


      Als Kernbrennstoff gilt Plutonium, Uran 233, Uran 235 (einschließlich Uran 235, welches in Uran enthalten ist, das mit mehr als 2,1 Gewichtsprozent Uran 235 angereichert wurde) sowie jede andere Substanz, welche geeignet ist, beträchtliche Mengen Atomenergie durch Kernspaltung oder -vereinigung oder eine andere Kernreaktion der Substanz freizumachen. Die vorstehenden Substanzen werden als Kernbrennstoff angesehen, einerlei in welchem chemischen oder physikalischen Zustand sie sich befinden.

  2. II.

    Biologische Waffen

    1. 3.

      Biologische Kampfmittel

      1. a)

        schädliche Insekten und deren toxische Produkte;

      2. b)

        biologische Agenzien (Mikroorganismen, Viren, Pilze sowie Toxine); insbesondere:

      1. 3.1

        human- und tierpathogene Erreger sowie Toxine

        1. a)

          Viren wie folgt:

          1. 1.


          2. 2.

            Haemorrhagisches Kongo-Krim-Fieber-Virus,

          3. 3.


          4. 4.

            Eastern Equine Enzephalitis-Virus,

          5. 5.


          6. 6.


          7. 7.


          8. 8.


          9. 9.

            Lymphozytäre Choriomeningitis-Virus,

          10. 10.


          11. 11.


          12. 12.


          13. 13.


          14. 14.

            Zeckenenzephalitis-Virus (Virus der russischen Frühjahr-/Sommerenzephalitis),

          15. 15.


          16. 16.

            Venezuelan Equine Enzephalitis-Virus,

          17. 17.

            Western Equine Enzephalitis-Virus,

          18. 18.


          19. 19.


          20. 20.


        2. b)

          Rickettsiae wie folgt:

          1. 1.

            Coxiella burnetii,

          2. 2.

            Bartonella quintana (Rochalimaea quintana, Rickettsia quintana),

          3. 3.

            Rickettsia prowazekii,

          4. 4.

            Rickettsia rickettsii;

        3. c)

          Bakterien wie folgt:

          1. 1.

            Bacillus anthracis,

          2. 2.

            Brucella abortus,

          3. 3.

            Brucella melitensis,

          4. 4.

            Brucella suis,

          5. 5.

            Chlamydia psittaci,

          6. 6.

            Clostridium botulinum,

          7. 7.

            Francisella tularensis,

          8. 8.

            Burkholderia mallei (Pseudomonas mallei),

          9. 9.

            Burkholderia pseudomallei (Pseudomonas pseudomallei),

          10. 10.

            Salmonella typhi,

          11. 11.

            Shigella dysenteriae,

          12. 12.

            Vibrio cholerae,

          13. 13.

            Yersinia pestis;

        4. d)

          Toxine wie folgt:

          1. 1.


          2. 2.


          3. 3.


          4. 4.


          5. 5.


          6. 6.


          7. 7.


          8. 8.


          9. 9.


          10. 10.

            Microcystin (Cyanoginosin);

      2. 3.2

        tierpathogene Erreger

        1. a)

          Viren wie folgt:

          1. 1.

            Afrikanisches Schweinepest-Virus,

          2. 2.

            Aviäre Influenza Viren wie folgt:

            1. a)

              uncharakterisiert oder

            2. b)

              Viren mit hoher Pathogenität gemäß Richtlinie 92/40/EWG des Rates vom 19. Juni 1992 mit Gemeinschaftsmaßnahmen zur Bekämpfung der Geflügelpest (ABl. EG Nr. L 167 S. 1) wie folgt:

              1. aa)

                Typ-A-Viren mit einem IVPI (intravenöser Pathogenitätsindex) in 6 Wochen alten Hühnern größer als 1,2 oder

              2. bb)

                Typ-A-Viren vom Subtyp H5 oder H7, für welche die Nukleotid-Sequenzierung an der Spaltstelle für Hämagglutinin multiple basische Aminosäuren aufweist,

          3. 3.


          4. 4.

            Maul- und Klauenseuche-Virus,

          5. 5.


          6. 6.


          7. 7.

            Schweinepest-Virus (Hog cholera-Virus),

          8. 8.


          9. 9.


          10. 10.

            Virus der Pest der kleinen Wiederkäuer,

          11. 11.

            Schweine-Entero-Virus vom Typ 9 (Virus der vesikulären Schweinekrankheit),

          12. 12.


          13. 13.


          14. 14.


          15. 15.

            Vesikuläre Stomatitis-Virus;

        2. b)

          Bakterien wie folgt:

          Mycoplasma mycoides;

      3. 3.3

        pflanzenpathogene Erreger

        1. a)

          Bakterien wie folgt:

          1. 1.

            Xanthomonas albilineans,

          2. 2.

            Xanthomonas campestries pv. citri einschließlich darauf zurückzuführender Stämme wie Xanthomonas campestris pv. citri Typen A, B, C, D, E oder anders klassifizierte wie Xanthomonas citri, Xanthomonas campestris pv. aurantifolia oder Xanthomonas pv. campestris pv. citromelo;

        2. b)

          Pilze wie folgt:

          1. 1.

            Colletotrichum coffeanum var. virulans (Colletotrichum kahawae),

          2. 2.

            Cochliobolus miyabeanus (Helminthosporium oryzae),

          3. 3.

            Micricyclus ulei (syn. Dothidella ulei),

          4. 4.

            Puccina graminis (syn. Puccina graminis f. sp. tritici),

          5. 5.

            Puccina striiformis (syn. Puccina glumarum),

          6. 6.

            Magnaporthe grisea (Pyricularia grisea/Pyricularia oryzae);

      4. 3.4

        genetisch modifizierte Mikroorganismen wie folgt:

        1. a)

          genetisch modifizierte Mikroorganismen oder genetische Elemente, die Nukleinsäuresequenzen enthalten, welche mit der Pathogenität der in Unternummer 3.1 Buchstabe a, b oder c oder Unternummer 3.2 oder 3.3 genannten Organismen assoziiert sind,

        2. b)

          genetisch modifizierte Mikroorganismen oder genetische Elemente, die eine Nukleinsäuresequenz-Kodierung für eines der in Unternummer 3.1 Buchstabe d genannten Toxine enthalten.

    2. 4.

      Einrichtungen oder Geräte, die eigens dazu bestimmt sind, die in Nummer 3 genannten biologischen Kampfmittel für militärische Zwecke zu verwenden, sowie Teile oder Baugruppen, die eigens zur Verwendung in einer solchen Waffe bestimmt sind.

  3. III.

    Chemische Waffen

    1. 5.
      1. A.

        Toxische Chemikalien

        (Registriernummer nach Chemical Abstracts Service; CAS-Nummer)

        a)O-Alkyl(<= C10 einschließlich Cycloalkyl)-alkyl-(Me, Et, n-Pr oder i-Pr)-phosphonofluoride, zum Beispiel: 
         O-Isopropylmethylphosphonofluorid (107-44-8),
        b)O-Alkyl(<= C10 einschließlich Cycloalkyl)-N,N-dialkyl(Me, Et, n-Pr oder i-Pr)-phosphoramindo-cyanide, zum Beispiel: 
         O-Ethyl-N,N-dimethylphosphoramid- ocyanid(77-81-6),
        c)O-Alkyl(H oder <= C10 einschließlich Cycloalkyl)-S-2-dialkyl(Me, Et, n-Pr oder i-Pr)-aminoethylalkyl (Me, Et, n-Pr oder i-Pr)-phosphonothiolate sowie entsprechende alkylierte und protonierte Salze, zum Beispiel: 
         O-Ethyl-S-2-diisopropylaminoethylmethyl- phosphonothiolat(50782-69-9),
         Sesqui-Yperit (Q): 
         Lewisit 1: 
         Lewisit 2: 
         Lewisit 3: 
         Bis-(2-chlorethyl)-ethylamin (538-07-8),
      2. B.


        a)Alkyl (Me, Et, n-Pr oder i-Pr)phosphonsäuredifluoride, zum Beispiel: 
        b)O-Alkyl(H oder <= C10 einschließlich Cycloalkyl)-0-2-Dialkyl(Me, Et, n-Pr oder i-Pr)-aminoethylalkyl (Me, Et, n-Pr oder i-Pr)-phosphonite und entsprechende alkylierte und protonierte Salze, zum Beispiel:  
         O-Ethyl-O-2-diisopropylaminoethylmethyl- phosphonit(57856-11-8),
    2. 6.

      Einrichtungen oder Geräte, die eigens dazu bestimmt sind, die in Nummer 5 genannten chemischen Kampfstoffe für militärische Zwecke zu verwenden, sowie Teile oder Baugruppen, die eigens zur Verwendung in einer solchen Waffe bestimmt sind.

Teil B

Sonstige Kriegswaffen

  1. I.


    1. 7.


    2. 8.

      ungelenkte Flugkörper (Raketen)

    3. 9.

      sonstige Flugkörper

    4. 10.

      Abfeuereinrichtungen (Startanlagen und Startgeräte) für die Waffen der Nummern 7 und 9 einschließlich der tragbaren Abfeuereinrichtungen für Lenkflugkörper zur Panzer- und Fliegerabwehr

    5. 11.

      Abfeuereinrichtungen für die Waffen der Nummer 8 einschließlich der tragbaren Abfeuereinrichtungen sowie der Raketenwerfer

    6. 12.

      Triebwerke für die Waffen der Nummern 7 bis 9

  2. II.

    Kampfflugzeuge und -hubschrauber

    1. 13.

      Kampfflugzeuge, wenn sie mindestens eines der folgenden Merkmale besitzen:

      1. 1.

        integriertes Waffensystem, das insbesondere über Zielauffassung, Feuerleitung und entsprechende Schnittstellen zur Avionik verfügt,

      2. 2.

        integrierte elektronische Kampfmittel,

      3. 3.

        integriertes elektronisches Kampfführungssystem

    2. 14.

      Kampfhubschrauber, wenn sie mindestens eines der folgenden Merkmale besitzen:

      1. 1.

        integriertes Waffensystem, das insbesondere über Zielauffassung, Feuerleitung und entsprechende Schnittstellen zur Avionik verfügt,

      2. 2.

        integrierte elektronische Kampfmittel,

      3. 3.

        integriertes elektronisches Kampfführungssystem

    3. 15.

      Zellen für die Waffen der Nummern 13 und 14

    4. 16.

      Strahl-, Propellerturbinen- und Raketentriebwerke für die Waffen der Nummer 13

  3. III.

    Kriegsschiffe und schwimmende Unterstützungsfahrzeuge

    1. 17.

      Kriegsschiffe einschließlich solcher, die für die Ausbildung verwendet werden

    2. 18.


    3. 19.

      kleine Wasserfahrzeuge mit einer Geschwindigkeit von mehr als 30 Knoten, die mit Angriffswaffen ausgerüstet sind

    4. 20.

      Minenräumboote, Minenjagdboote, Minenleger, Sperrbrecher sowie sonstige Minenkampfboote

    5. 21.

      Landungsboote, Landungsschiffe

    6. 22.

      Tender, Munitionstransporter

    7. 23.

      Rümpfe für die Waffen der Nummern 17 bis 22

  4. IV.


    1. 24.


    2. 25.

      sonstige gepanzerte Kampffahrzeuge einschließlich der gepanzerten kampfunterstützenden Fahrzeuge

    3. 26.

      Spezialfahrzeuge aller Art, die ausschließlich für den Einsatz der Waffen der Nummern 1 bis 6 entwickelt sind

    4. 27.

      Fahrgestelle für die Waffen der Nummern 24 und 25

    5. 28.

      Türme für Kampfpanzer

  5. V.


    1. 29.
      1. a)

        Maschinengewehre, ausgenommen solche mit Wasserkühlung,

      2. b)

        Maschinenpistolen, ausgenommen solche, die als Modell vor dem 2. September 1945 bei einer militärischen Streitkraft eingeführt worden sind,

      3. c)

        vollautomatische Gewehre, ausgenommen solche, die als Modell vor dem 2. September 1945 bei einer militärischen Streitkraft eingeführt worden sind,

      4. d)

        halbautomatische Gewehre mit Ausnahme derjenigen, die als Modell vor dem 2. September 1945 bei einer militärischen Streitkraft eingeführt worden sind, und der Jagd- und Sportgewehre

    2. 30.

      Granatmaschinenwaffen, Granatgewehre, Granatpistolen

    3. 31.

      Kanonen, Haubitzen, Mörser jeder Art

    4. 32.


    5. 33.

      gepanzerte Selbstfahrlafetten für die Waffen der Nummern 31 und 32

    6. 34.

      Rohre für die Waffen der Nummern 29, 31 und 32

    7. 35.

      Verschlüsse für die Waffen der Nummern 29, 31 und 32

    8. 36.

      Trommeln für Maschinenkanonen

  6. VI.

    Leichte Panzerabwehrwaffen, Flammenwerfer, Minenleg- und Minenwurfsysteme

    1. 37.

      rückstoßarme, ungelenkte, tragbare Panzerabwehrwaffen

    2. 38.


    3. 39.

      Minenleg- und Minenwurfsysteme für Landminen

  7. VII.

    Torpedos, Minen, Bomben, eigenständige Munition

    1. 40.


    2. 41.

      Torpedos ohne Gefechtskopf (Sprengstoffteil)

    3. 42.

      Rumpftorpedos (Torpedos ohne Gefechtskopf - Sprengstoffteil - und ohne Zielsuchkopf)

    4. 43.

      Minen aller Art

    5. 44.

      Bomben aller Art einschließlich der Wasserbomben

    6. 45.


    7. 46.


    8. 47.

      Pioniersprengkörper, Hohl- und Haftladungen sowie sprengtechnische Minenräummittel

    9. 48.

      Sprengladungen für die Waffen der Nummer 43

  8. VIII.

    Sonstige Munition

    1. 49.

      Munition für die Waffen der Nummern 31 und 32

    2. 50.

      Munition für die Waffen der Nummer 29, ausgenommen Patronenmunition mit Vollmantelweichkerngeschoss, sofern

      1. 1.

        das Geschoss keine Zusätze, insbesondere einen Lichtspur-, Brand- oder Sprengsatz, enthält und

      2. 2.

        Patronenmunition gleichen Kalibers für Jagd- oder Sportzwecke verwendet wird.

    3. 51.

      Munition für die Waffen der Nummer 30

    4. 52.

      Munition für die Waffen der Nummern 37 und 39

    5. 53.


    6. 54.

      Geschosse für die Waffen der Nummern 49 und 52

    7. 55.

      Treibladungen für die Waffen der Nummern 49 und 52

  9. IX.

    Sonstige wesentliche Bestandteile

    1. 56.

      Gefechtsköpfe für die Waffen der Nummern 7 bis 9 und 40

    2. 57.

      Zünder für die Waffen der Nummern 7 bis 9, 40, 43, 44, 46, 47, 49, 51 bis 53 und 59, ausgenommen Treibladungsanzünder

    3. 58.

      Zielsuchköpfe für die Waffen der Nummern 7, 9, 40, 44, 49, 59 und 60

    4. 59.

      Submunition für die Waffen der Nummern 7 bis 9, 44, 49 und 61

    5. 60.

      Submunition ohne Zünder für die Waffen der Nummern 7 bis 9, 44, 49 und 61

  10. X.


    1. 61.

      Dispenser zur systematischen Verteilung von Submunition

  11. XI.


    1. 62.

      Laserwaffen, besonders dafür konstruiert, dauerhafte Erblindung zu verursachen.

(1) Amtl. Anm.:

Für die unter Nummer 3 Buchstabe b genannten biologischen Agenzien sind im Falle ihrer zivilen Verwendung die Ausfuhrbeschränkungen auf Grund

  • der Verordnung (EG) Nr. 3381/94 des Rates vom 19. Dezember 1994 über eine Gemeinschaftsregelung der Ausfuhrkontrolle von Gütern mit doppeltem Verwendungszweck (ABl. EG Nr. L 367 S. 1) in Verbindung mit dem Beschluss des Rates vom 19. Dezember 1994 über die vom Rat gemäß Artikel J.3 des Vertrages über die Europäische Union angenommene gemeinsame Aktion zur Ausfuhrkontrolle von Gütern mit doppeltem Verwendungszweck (ABl. EG Nr. L 367 S. 8) sowie
  • der Regelungen der Außenwirtschaftsverordnung, insbesondere der §§ 5 und 7 Abs. 4, zu beachten.

Für Ricin und Saxitoxin (Nummer 3.1 Buchstabe d und Nummern 4 und 5) gelten zusätzlich die Beschränkungen, Meldepflichten und Inspektionsvorschriften des Ausführungsgesetzes zum Chemiewaffenübereinkommen vom 2. August 1994 (BGBl. I S. 1954) und der Ausführungsverordnung zum Chemiewaffenübereinkommen vom 20. November 1996 (BGBl. I S. 1794).